C13H14ClNO3S2 — CID 171876112
S-[4-(2-chloro-1,3-benzothiazol-6-yl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876112) has the molecular formula C13H14ClNO3S2 and a molecular weight of 331.85 g/mol. Its IUPAC name is S-[4-(2-chloro-1,3-benzothiazol-6-yl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(2-chloro-1,3-benzothiazol-6-yl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876112 |
| Molecular Formula | C13H14ClNO3S2 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | S-[4-(2-chloro-1,3-benzothiazol-6-yl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C13H14ClNO3S2/c1-7(16)19-5-4-10(17)12(18)8-2-3-9-11(6-8)20-13(14)15-9/h2-3,6,10,12,17-18H,4-5H2,1H3 |
| InChIKey | KFFUZNWRSODHTE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|