C15H17FO5S — CID 171876740
(E)-3-[5-(4-acetylsulfanyl-1,2-dihydroxybutyl)-2-fluorophenyl]prop-2-enoic acid (PubChem CID 171876740) has the molecular formula C15H17FO5S and a molecular weight of 328.36 g/mol. Its IUPAC name is (E)-3-[5-(4-acetylsulfanyl-1,2-dihydroxybutyl)-2-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(4-acetylsulfanyl-1,2-dihydroxybutyl)-2-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171876740 |
| Molecular Formula | C15H17FO5S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | (E)-3-[5-(4-acetylsulfanyl-1,2-dihydroxybutyl)-2-fluorophenyl]prop-2-enoic acid |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc(F)c(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C15H17FO5S/c1-9(17)22-7-6-13(18)15(21)11-2-4-12(16)10(8-11)3-5-14(19)20/h2-5,8,13,15,18,21H,6-7H2,1H3,(H,19,20)/b5-3+ |
| InChIKey | KXWKIVARQXULQE-HWKANZROSA-N |
| XLogP | 1.99 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|