C12H14FNO5S — CID 171876324
S-[4-(3-fluoro-4-nitrophenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876324) has the molecular formula C12H14FNO5S and a molecular weight of 303.31 g/mol. Its IUPAC name is S-[4-(3-fluoro-4-nitrophenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(3-fluoro-4-nitrophenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876324 |
| Molecular Formula | C12H14FNO5S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | S-[4-(3-fluoro-4-nitrophenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C12H14FNO5S/c1-7(15)20-5-4-11(16)12(17)8-2-3-10(14(18)19)9(13)6-8/h2-3,6,11-12,16-17H,4-5H2,1H3 |
| InChIKey | UKIUESSLYYHWAN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|