C15H16N2O5S — CID 171876863
S-[3,4-dihydroxy-4-(8-nitroisoquinolin-5-yl)butyl] ethanethioate (PubChem CID 171876863) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is S-[3,4-dihydroxy-4-(8-nitroisoquinolin-5-yl)butyl] ethanethioate.
| Compound Name | S-[3,4-dihydroxy-4-(8-nitroisoquinolin-5-yl)butyl] ethanethioate |
|---|---|
| PubChem CID | 171876863 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | S-[3,4-dihydroxy-4-(8-nitroisoquinolin-5-yl)butyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc([N+](=O)[O-])c2cnccc12 |
| InChI | InChI=1S/C15H16N2O5S/c1-9(18)23-7-5-14(19)15(20)11-2-3-13(17(21)22)12-8-16-6-4-10(11)12/h2-4,6,8,14-15,19-20H,5,7H2,1H3 |
| InChIKey | FGFLMLWSKQIUTH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|