C14H18O5S — CID 171876075
S-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876075) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is S-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876075 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | S-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H18O5S/c1-9(15)20-7-4-11(16)14(17)10-2-3-12-13(8-10)19-6-5-18-12/h2-3,8,11,14,16-17H,4-7H2,1H3 |
| InChIKey | KPJRXSBEVGHSFJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|