C12H15BrO4 — CID 171860717
3-bromo-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propane-1,2-diol (PubChem CID 171860717) has the molecular formula C12H15BrO4 and a molecular weight of 303.15 g/mol. Its IUPAC name is 3-bromo-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propane-1,2-diol.
| Compound Name | 3-bromo-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 171860717 |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 3-bromo-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propane-1,2-diol |
| SMILES | OC(CBr)C(O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C12H15BrO4/c13-7-9(14)12(15)8-2-3-10-11(6-8)17-5-1-4-16-10/h2-3,6,9,12,14-15H,1,4-5,7H2 |
| InChIKey | OZOGUDKTIPBHHW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|