C17H23NO3 — CID 82216966
2-[bis(prop-2-enyl)amino]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethanol (PubChem CID 82216966) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)amino]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethanol.
| Compound Name | 2-[bis(prop-2-enyl)amino]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethanol |
|---|---|
| PubChem CID | 82216966 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-[bis(prop-2-enyl)amino]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethanol |
| SMILES | C=CCN(CC=C)CC(O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C17H23NO3/c1-3-8-18(9-4-2)13-15(19)14-6-7-16-17(12-14)21-11-5-10-20-16/h3-4,6-7,12,15,19H,1-2,5,8-11,13H2 |
| InChIKey | JQWGYXAKTIMYQT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|