C11H12ClNO3S — CID 171872528
1-(2-chloro-1,3-benzothiazol-6-yl)butane-1,2,4-triol (PubChem CID 171872528) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is 1-(2-chloro-1,3-benzothiazol-6-yl)butane-1,2,4-triol.
| Compound Name | 1-(2-chloro-1,3-benzothiazol-6-yl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872528 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 1-(2-chloro-1,3-benzothiazol-6-yl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1ccc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C11H12ClNO3S/c12-11-13-7-2-1-6(5-9(7)17-11)10(16)8(15)3-4-14/h1-2,5,8,10,14-16H,3-4H2 |
| InChIKey | QSNCBXOTBIBEOP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |