C11H13NO2S2 — CID 171874259
1-(1,3-benzothiazol-6-yl)-4-sulfanylbutane-1,2-diol (PubChem CID 171874259) has the molecular formula C11H13NO2S2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-6-yl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(1,3-benzothiazol-6-yl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171874259 |
| Molecular Formula | C11H13NO2S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 1-(1,3-benzothiazol-6-yl)-4-sulfanylbutane-1,2-diol |
| SMILES | OC(CCS)C(O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C11H13NO2S2/c13-9(3-4-15)11(14)7-1-2-8-10(5-7)16-6-12-8/h1-2,5-6,9,11,13-15H,3-4H2 |
| InChIKey | BWTNDCAGALKLJJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|