C11H13ClN2O4S2 — CID 58454473
2-chloro-N,N-bis(2-hydroxyethyl)-1,3-benzothiazole-6-sulfonamide (PubChem CID 58454473) has the molecular formula C11H13ClN2O4S2 and a molecular weight of 336.82 g/mol. Its IUPAC name is 2-chloro-N,N-bis(2-hydroxyethyl)-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 2-chloro-N,N-bis(2-hydroxyethyl)-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 58454473 |
| Molecular Formula | C11H13ClN2O4S2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 2-chloro-N,N-bis(2-hydroxyethyl)-1,3-benzothiazole-6-sulfonamide |
| SMILES | O=S(=O)(c1ccc2nc(Cl)sc2c1)N(CCO)CCO |
| InChI | InChI=1S/C11H13ClN2O4S2/c12-11-13-9-2-1-8(7-10(9)19-11)20(17,18)14(3-5-15)4-6-16/h1-2,7,15-16H,3-6H2 |
| InChIKey | UHGDTEOHTKSWTL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |