C12H8ClN3O2S2 — CID 172736543
2-chloro-6-(1,4-diazepin-1-ylsulfonyl)-1,3-benzothiazole (PubChem CID 172736543) has the molecular formula C12H8ClN3O2S2 and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-chloro-6-(1,4-diazepin-1-ylsulfonyl)-1,3-benzothiazole.
| Compound Name | 2-chloro-6-(1,4-diazepin-1-ylsulfonyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 172736543 |
| Molecular Formula | C12H8ClN3O2S2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | 2-chloro-6-(1,4-diazepin-1-ylsulfonyl)-1,3-benzothiazole |
| SMILES | O=S(=O)(c1ccc2nc(Cl)sc2c1)N1C=CC=NC=C1 |
| InChI | InChI=1S/C12H8ClN3O2S2/c13-12-15-10-3-2-9(8-11(10)19-12)20(17,18)16-6-1-4-14-5-7-16/h1-8H |
| InChIKey | INCVZZKACYHNHY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |