About 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide
2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide (PubChem CID 71852001) has the molecular formula C17H16ClN3O4S2
and a molecular weight of 425.92 g/mol. Its IUPAC name is 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide |
| PubChem CID | 71852001 |
| Molecular Formula | C17H16ClN3O4S2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COc1ccc(NS(=O)(=O)c2ccc3nc(Cl)sc3c2)cc1 |
| InChI | InChI=1S/C17H16ClN3O4S2/c1-21(2)16(22)10-25-12-5-3-11(4-6-12)20-27(23,24)13-7-8-14-15(9-13)26-17(18)19-14/h3-9,20H,10H2,1-2H3 |
| InChIKey | CUDYXISUJUPIKU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide?
The IUPAC name of 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide (CID 71852001) is 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide?
The canonical SMILES for 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide is CN(C)C(=O)COc1ccc(NS(=O)(=O)c2ccc3nc(Cl)sc3c2)cc1.
What is the InChIKey of 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide?
The InChIKey is CUDYXISUJUPIKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3O4S2/c1-21(2)16(22)10-25-12-5-3-11(4-6-12)20-27(23,24)13-7-8-14-15(9-13)26-17(18)19-14/h3-9,20H,10H2,1-2H3.
What are the key properties of 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide?
2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide has a molecular weight of 425.92 g/mol, XLogP of 3.22, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-chloro-1,3-benzothiazol-6-yl)sulfonylamino]phenoxy]-N,N-dimethylacetamide is sourced from PubChem (CID 71852001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).