C12H14N2O3S3 — CID 847943
4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl]morpholine (PubChem CID 847943) has the molecular formula C12H14N2O3S3 and a molecular weight of 330.46 g/mol. Its IUPAC name is 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl]morpholine.
| Compound Name | 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl]morpholine |
|---|---|
| PubChem CID | 847943 |
| Molecular Formula | C12H14N2O3S3 |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 4-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl]morpholine |
| SMILES | CSc1nc2ccc(S(=O)(=O)N3CCOCC3)cc2s1 |
| InChI | InChI=1S/C12H14N2O3S3/c1-18-12-13-10-3-2-9(8-11(10)19-12)20(15,16)14-4-6-17-7-5-14/h2-3,8H,4-7H2,1H3 |
| InChIKey | VJHYYHXMAKYSFW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |