C17H23N3O4S2 — CID 4057276
2-ethyl-N-(6-morpholin-4-ylsulfonyl-1,3-benzothiazol-2-yl)butanamide (PubChem CID 4057276) has the molecular formula C17H23N3O4S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-ethyl-N-(6-morpholin-4-ylsulfonyl-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 2-ethyl-N-(6-morpholin-4-ylsulfonyl-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 4057276 |
| Molecular Formula | C17H23N3O4S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-ethyl-N-(6-morpholin-4-ylsulfonyl-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CCC(CC)C(=O)Nc1nc2ccc(S(=O)(=O)N3CCOCC3)cc2s1 |
| InChI | InChI=1S/C17H23N3O4S2/c1-3-12(4-2)16(21)19-17-18-14-6-5-13(11-15(14)25-17)26(22,23)20-7-9-24-10-8-20/h5-6,11-12H,3-4,7-10H2,1-2H3,(H,18,19,21) |
| InChIKey | BTJMXVFXEOFKGE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |