C20H20ClN3O4S2 — CID 26243825
2-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 26243825) has the molecular formula C20H20ClN3O4S2 and a molecular weight of 465.98 g/mol. Its IUPAC name is 2-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26243825 |
| Molecular Formula | C20H20ClN3O4S2 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 2-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCc1ccc2nc(NC(=O)c3cc(S(=O)(=O)N4CCOCC4)ccc3Cl)sc2c1 |
| InChI | InChI=1S/C20H20ClN3O4S2/c1-2-13-3-6-17-18(11-13)29-20(22-17)23-19(25)15-12-14(4-5-16(15)21)30(26,27)24-7-9-28-10-8-24/h3-6,11-12H,2,7-10H2,1H3,(H,22,23,25) |
| InChIKey | RNYITYPRXLSANM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |