C17H15N3O5S3 — CID 5136024
4-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]sulfonylmorpholine (PubChem CID 5136024) has the molecular formula C17H15N3O5S3 and a molecular weight of 437.52 g/mol. Its IUPAC name is 4-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]sulfonylmorpholine.
| Compound Name | 4-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 5136024 |
| Molecular Formula | C17H15N3O5S3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 4-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]sulfonylmorpholine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCOCC2)ccc1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H15N3O5S3/c21-20(22)14-11-12(28(23,24)19-7-9-25-10-8-19)5-6-16(14)27-17-18-13-3-1-2-4-15(13)26-17/h1-6,11H,7-10H2 |
| InChIKey | XPVVGRWCHYFJDC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|