C15H17N5O5S2 — CID 24653612
4-[3-nitro-4-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]sulfonylmorpholine (PubChem CID 24653612) has the molecular formula C15H17N5O5S2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-[3-nitro-4-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-nitro-4-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 24653612 |
| Molecular Formula | C15H17N5O5S2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 4-[3-nitro-4-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]sulfonylmorpholine |
| SMILES | C=CCn1cnnc1Sc1ccc(S(=O)(=O)N2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N5O5S2/c1-2-5-18-11-16-17-15(18)26-14-4-3-12(10-13(14)20(21)22)27(23,24)19-6-8-25-9-7-19/h2-4,10-11H,1,5-9H2 |
| InChIKey | ZBNIYBJUZUNIER-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 120.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|