C23H28N6O5S2 — CID 98384382
(1R)-N,N-dimethyl-1-[5-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)sulfanyl-4-phenyl-1,2,4-triazol-3-yl]propan-1-amine (PubChem CID 98384382) has the molecular formula C23H28N6O5S2 and a molecular weight of 532.65 g/mol. Its IUPAC name is (1R)-N,N-dimethyl-1-[5-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)sulfanyl-4-phenyl-1,2,4-triazol-3-yl]propan-1-amine.
| Compound Name | (1R)-N,N-dimethyl-1-[5-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)sulfanyl-4-phenyl-1,2,4-triazol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 98384382 |
| Molecular Formula | C23H28N6O5S2 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | (1R)-N,N-dimethyl-1-[5-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)sulfanyl-4-phenyl-1,2,4-triazol-3-yl]propan-1-amine |
| SMILES | CC[C@H](c1nnc(Sc2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])n1-c1ccccc1)N(C)C |
| InChI | InChI=1S/C23H28N6O5S2/c1-4-19(26(2)3)22-24-25-23(28(22)17-8-6-5-7-9-17)35-21-11-10-18(16-20(21)29(30)31)36(32,33)27-12-14-34-15-13-27/h5-11,16,19H,4,12-15H2,1-3H3/t19-/m1/s1 |
| InChIKey | PWOXEYVERJRINE-LJQANCHMSA-N |
| XLogP | 3.36 |
| TPSA | 123.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|