C17H20N3O4S2+ — CID 9279159
1-methyl-4-(3-nitro-4-phenylsulfanylphenyl)sulfonylpiperazin-1-ium (PubChem CID 9279159) has the molecular formula C17H20N3O4S2+ and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-methyl-4-(3-nitro-4-phenylsulfanylphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-methyl-4-(3-nitro-4-phenylsulfanylphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 9279159 |
| Molecular Formula | C17H20N3O4S2+ |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1-methyl-4-(3-nitro-4-phenylsulfanylphenyl)sulfonylpiperazin-1-ium |
| SMILES | C[NH+]1CCN(S(=O)(=O)c2ccc(Sc3ccccc3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C17H19N3O4S2/c1-18-9-11-19(12-10-18)26(23,24)15-7-8-17(16(13-15)20(21)22)25-14-5-3-2-4-6-14/h2-8,13H,9-12H2,1H3/p+1 |
| InChIKey | RFTQJNASMDFWNG-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|