C13H15N5O4S2 — CID 4780644
4-methyl-3-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)sulfanyl-1,2,4-triazole (PubChem CID 4780644) has the molecular formula C13H15N5O4S2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 4-methyl-3-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)sulfanyl-1,2,4-triazole.
| Compound Name | 4-methyl-3-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)sulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 4780644 |
| Molecular Formula | C13H15N5O4S2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 4-methyl-3-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)sulfanyl-1,2,4-triazole |
| SMILES | Cn1cnnc1Sc1ccc(S(=O)(=O)N2CCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N5O4S2/c1-16-9-14-15-13(16)23-12-5-4-10(8-11(12)18(19)20)24(21,22)17-6-2-3-7-17/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | OLAHBXGFMBWDQQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 111.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|