C13H17N5O4S2 — CID 4781037
N,N-diethyl-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzenesulfonamide (PubChem CID 4781037) has the molecular formula C13H17N5O4S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is N,N-diethyl-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4781037 |
| Molecular Formula | C13H17N5O4S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N,N-diethyl-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Sc2nncn2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17N5O4S2/c1-4-17(5-2)24(21,22)10-6-7-12(11(8-10)18(19)20)23-13-15-14-9-16(13)3/h6-9H,4-5H2,1-3H3 |
| InChIKey | YEKKAOQHDMULJF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 111.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|