C18H18N6O4S2 — CID 24631960
N,N-diethyl-3-nitro-4-(3H-[1,2,4]triazolo[4,3-a]benzimidazol-1-ylsulfanyl)benzenesulfonamide (PubChem CID 24631960) has the molecular formula C18H18N6O4S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is N,N-diethyl-3-nitro-4-(3H-[1,2,4]triazolo[4,3-a]benzimidazol-1-ylsulfanyl)benzenesulfonamide.
| Compound Name | N,N-diethyl-3-nitro-4-(3H-[1,2,4]triazolo[4,3-a]benzimidazol-1-ylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 24631960 |
| Molecular Formula | C18H18N6O4S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | N,N-diethyl-3-nitro-4-(3H-[1,2,4]triazolo[4,3-a]benzimidazol-1-ylsulfanyl)benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Sc2n[nH]c3nc4ccccc4n23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N6O4S2/c1-3-22(4-2)30(27,28)12-9-10-16(15(11-12)24(25)26)29-18-21-20-17-19-13-7-5-6-8-14(13)23(17)18/h5-11H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | NAONAMONKKMNFX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|