C19H23N5O5S2 — CID 24567116
N,N-diethyl-4-[[4-ethyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-nitrobenzenesulfonamide (PubChem CID 24567116) has the molecular formula C19H23N5O5S2 and a molecular weight of 465.56 g/mol. Its IUPAC name is N,N-diethyl-4-[[4-ethyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[[4-ethyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24567116 |
| Molecular Formula | C19H23N5O5S2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N,N-diethyl-4-[[4-ethyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Sc2nnc(-c3ccoc3C)n2CC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H23N5O5S2/c1-5-22(6-2)31(27,28)14-8-9-17(16(12-14)24(25)26)30-19-21-20-18(23(19)7-3)15-10-11-29-13(15)4/h8-12H,5-7H2,1-4H3 |
| InChIKey | JDGCVURJKHVCQZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 124.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|