C19H24N4O5S2 — CID 29107164
2-cyclohexyl-5-(2-nitro-4-piperidin-1-ylsulfonylphenyl)sulfanyl-1,3,4-oxadiazole (PubChem CID 29107164) has the molecular formula C19H24N4O5S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-cyclohexyl-5-(2-nitro-4-piperidin-1-ylsulfonylphenyl)sulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-cyclohexyl-5-(2-nitro-4-piperidin-1-ylsulfonylphenyl)sulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 29107164 |
| Molecular Formula | C19H24N4O5S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 2-cyclohexyl-5-(2-nitro-4-piperidin-1-ylsulfonylphenyl)sulfanyl-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1Sc1nnc(C2CCCCC2)o1 |
| InChI | InChI=1S/C19H24N4O5S2/c24-23(25)16-13-15(30(26,27)22-11-5-2-6-12-22)9-10-17(16)29-19-21-20-18(28-19)14-7-3-1-4-8-14/h9-10,13-14H,1-8,11-12H2 |
| InChIKey | ZTCCJTPBDOEOPI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 119.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|