C17H21N5O4S2 — CID 24653626
4-methyl-1-[3-nitro-4-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]sulfonylpiperidine (PubChem CID 24653626) has the molecular formula C17H21N5O4S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-methyl-1-[3-nitro-4-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]sulfonylpiperidine.
| Compound Name | 4-methyl-1-[3-nitro-4-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 24653626 |
| Molecular Formula | C17H21N5O4S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 4-methyl-1-[3-nitro-4-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]sulfonylpiperidine |
| SMILES | C=CCn1cnnc1Sc1ccc(S(=O)(=O)N2CCC(C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N5O4S2/c1-3-8-20-12-18-19-17(20)27-16-5-4-14(11-15(16)22(23)24)28(25,26)21-9-6-13(2)7-10-21/h3-5,11-13H,1,6-10H2,2H3 |
| InChIKey | COZVOVZDRKJNFF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 111.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|