C16H21N5O4S2 — CID 18272338
1-[4-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]sulfonyl-4-methylpiperidine (PubChem CID 18272338) has the molecular formula C16H21N5O4S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[4-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]sulfonyl-4-methylpiperidine.
| Compound Name | 1-[4-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]sulfonyl-4-methylpiperidine |
|---|---|
| PubChem CID | 18272338 |
| Molecular Formula | C16H21N5O4S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 1-[4-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]sulfonyl-4-methylpiperidine |
| SMILES | CCc1nc(Sc2ccc(S(=O)(=O)N3CCC(C)CC3)cc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C16H21N5O4S2/c1-3-15-17-16(19-18-15)26-14-5-4-12(10-13(14)21(22)23)27(24,25)20-8-6-11(2)7-9-20/h4-5,10-11H,3,6-9H2,1-2H3,(H,17,18,19) |
| InChIKey | KADSADBQGXTJAS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|