C30H40N4O11S2 — CID 158733620
ethyl 3-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-2-oxopropanoate;4-methyl-1-(4-methyl-3-nitrophenyl)sulfonylpiperidine (PubChem CID 158733620) has the molecular formula C30H40N4O11S2 and a molecular weight of 696.80 g/mol. Its IUPAC name is ethyl 3-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-2-oxopropanoate;4-methyl-1-(4-methyl-3-nitrophenyl)sulfonylpiperidine.
| Compound Name | ethyl 3-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-2-oxopropanoate;4-methyl-1-(4-methyl-3-nitrophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 158733620 |
| Molecular Formula | C30H40N4O11S2 |
| Molecular Weight | 696.80 g/mol |
| Exact Mass | 696.21 |
| IUPAC Name | ethyl 3-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-2-oxopropanoate;4-methyl-1-(4-methyl-3-nitrophenyl)sulfonylpiperidine |
| SMILES | CCOC(=O)C(=O)Cc1ccc(S(=O)(=O)N2CCC(C)CC2)cc1[N+](=O)[O-].Cc1ccc(S(=O)(=O)N2CCC(C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N2O7S.C13H18N2O4S/c1-3-26-17(21)16(20)10-13-4-5-14(11-15(13)19(22)23)27(24,25)18-8-6-12(2)7-9-18;1-10-5-7-14(8-6-10)20(18,19)12-4-3-11(2)13(9-12)15(16)17/h4-5,11-12H,3,6-10H2,1-2H3;3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | ILKAZUIPHMXYCA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 204.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|