C34H44N4O11S2 — CID 158385974
ethyl 6-(4-methylpiperidin-1-yl)sulfonyl-1H-indole-2-carboxylate;ethyl 3-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-2-oxopropanoate (PubChem CID 158385974) has the molecular formula C34H44N4O11S2 and a molecular weight of 748.88 g/mol. Its IUPAC name is ethyl 6-(4-methylpiperidin-1-yl)sulfonyl-1H-indole-2-carboxylate;ethyl 3-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-2-oxopropanoate.
| Compound Name | ethyl 6-(4-methylpiperidin-1-yl)sulfonyl-1H-indole-2-carboxylate;ethyl 3-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-2-oxopropanoate |
|---|---|
| PubChem CID | 158385974 |
| Molecular Formula | C34H44N4O11S2 |
| Molecular Weight | 748.88 g/mol |
| Exact Mass | 748.24 |
| IUPAC Name | ethyl 6-(4-methylpiperidin-1-yl)sulfonyl-1H-indole-2-carboxylate;ethyl 3-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)Cc1ccc(S(=O)(=O)N2CCC(C)CC2)cc1[N+](=O)[O-].CCOC(=O)c1cc2ccc(S(=O)(=O)N3CCC(C)CC3)cc2[nH]1 |
| InChI | InChI=1S/C17H22N2O7S.C17H22N2O4S/c1-3-26-17(21)16(20)10-13-4-5-14(11-15(13)19(22)23)27(24,25)18-8-6-12(2)7-9-18;1-3-23-17(20)16-10-13-4-5-14(11-15(13)18-16)24(21,22)19-8-6-12(2)7-9-19/h4-5,11-12H,3,6-10H2,1-2H3;4-5,10-12,18H,3,6-9H2,1-2H3 |
| InChIKey | GWJMWHMULSPXEO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 203.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.88 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|