C18H24N4O6S — CID 4845767
1-(furan-2-yl)-N,N-dimethyl-N'-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)ethane-1,2-diamine (PubChem CID 4845767) has the molecular formula C18H24N4O6S and a molecular weight of 424.48 g/mol. Its IUPAC name is 1-(furan-2-yl)-N,N-dimethyl-N'-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)ethane-1,2-diamine.
| Compound Name | 1-(furan-2-yl)-N,N-dimethyl-N'-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 4845767 |
| Molecular Formula | C18H24N4O6S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-(furan-2-yl)-N,N-dimethyl-N'-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)ethane-1,2-diamine |
| SMILES | CN(C)C(CNc1ccc(S(=O)(=O)N2CCOCC2)cc1[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C18H24N4O6S/c1-20(2)17(18-4-3-9-28-18)13-19-15-6-5-14(12-16(15)22(23)24)29(25,26)21-7-10-27-11-8-21/h3-6,9,12,17,19H,7-8,10-11,13H2,1-2H3 |
| InChIKey | JBRNXKVQGLOCEC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|