C18H27N5O5S — CID 55346473
N-[2-(dimethylamino)ethyl]-4-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-3-nitrobenzenesulfonamide (PubChem CID 55346473) has the molecular formula C18H27N5O5S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55346473 |
| Molecular Formula | C18H27N5O5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(NCC(c2ccco2)N(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H27N5O5S/c1-21(2)10-9-20-29(26,27)14-7-8-15(16(12-14)23(24)25)19-13-17(22(3)4)18-6-5-11-28-18/h5-8,11-12,17,19-20H,9-10,13H2,1-4H3 |
| InChIKey | KPZVUKPDMBFHGG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|