C18H25N4O5S+ — CID 9183305
4-[[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]amino]-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 9183305) has the molecular formula C18H25N4O5S+ and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-[[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]amino]-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]amino]-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9183305 |
| Molecular Formula | C18H25N4O5S+ |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-[[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]amino]-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NC[C@@H](c2ccco2)[NH+]2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H24N4O5S/c1-19-28(25,26)14-7-8-15(16(12-14)22(23)24)20-13-17(18-6-5-11-27-18)21-9-3-2-4-10-21/h5-8,11-12,17,19-20H,2-4,9-10,13H2,1H3/p+1/t17-/m0/s1 |
| InChIKey | XMNLPQUONANAHJ-KRWDZBQOSA-O |
| XLogP | 1.32 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|