C18H28N4O4S — CID 30790767
4-[[(2R)-2-[bis(prop-2-enyl)amino]-3-methylbutyl]amino]-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 30790767) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is 4-[[(2R)-2-[bis(prop-2-enyl)amino]-3-methylbutyl]amino]-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[(2R)-2-[bis(prop-2-enyl)amino]-3-methylbutyl]amino]-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 30790767 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-[[(2R)-2-[bis(prop-2-enyl)amino]-3-methylbutyl]amino]-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | C=CCN(CC=C)[C@@H](CNc1ccc(S(=O)(=O)NC)cc1[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C18H28N4O4S/c1-6-10-21(11-7-2)18(14(3)4)13-20-16-9-8-15(27(25,26)19-5)12-17(16)22(23)24/h6-9,12,14,18-20H,1-2,10-11,13H2,3-5H3/t18-/m0/s1 |
| InChIKey | LIAZHSORYPNPTC-SFHVURJKSA-N |
| XLogP | 2.61 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|