C23H24N4O5S2 — CID 4967325
4-[3-nitro-4-[(1-phenyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)sulfanyl]phenyl]sulfonylmorpholine (PubChem CID 4967325) has the molecular formula C23H24N4O5S2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 4-[3-nitro-4-[(1-phenyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)sulfanyl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-nitro-4-[(1-phenyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)sulfanyl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 4967325 |
| Molecular Formula | C23H24N4O5S2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 4-[3-nitro-4-[(1-phenyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)sulfanyl]phenyl]sulfonylmorpholine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCOCC2)ccc1Sc1nc2c(n1-c1ccccc1)CCCC2 |
| InChI | InChI=1S/C23H24N4O5S2/c28-27(29)21-16-18(34(30,31)25-12-14-32-15-13-25)10-11-22(21)33-23-24-19-8-4-5-9-20(19)26(23)17-6-2-1-3-7-17/h1-3,6-7,10-11,16H,4-5,8-9,12-15H2 |
| InChIKey | FRHRBAIQQGJOIF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|