C12H17N3O3S — CID 142983845
4-[(2-methyl-3H-benzimidazol-5-yl)sulfonyl]morpholine;molecular hydrogen (PubChem CID 142983845) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 4-[(2-methyl-3H-benzimidazol-5-yl)sulfonyl]morpholine;molecular hydrogen.
| Compound Name | 4-[(2-methyl-3H-benzimidazol-5-yl)sulfonyl]morpholine;molecular hydrogen |
|---|---|
| PubChem CID | 142983845 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4-[(2-methyl-3H-benzimidazol-5-yl)sulfonyl]morpholine;molecular hydrogen |
| SMILES | Cc1nc2ccc(S(=O)(=O)N3CCOCC3)cc2[nH]1.[H][H] |
| InChI | InChI=1S/C12H15N3O3S.H2/c1-9-13-11-3-2-10(8-12(11)14-9)19(16,17)15-4-6-18-7-5-15;/h2-3,8H,4-7H2,1H3,(H,13,14);1H |
| InChIKey | WDTSKSWLRAPADT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |