C19H19N3O5S — CID 103597300
methyl 2-(4-morpholin-4-ylsulfonylphenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 103597300) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is methyl 2-(4-morpholin-4-ylsulfonylphenyl)-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 2-(4-morpholin-4-ylsulfonylphenyl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 103597300 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | methyl 2-(4-morpholin-4-ylsulfonylphenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C19H19N3O5S/c1-26-19(23)14-4-7-16-17(12-14)21-18(20-16)13-2-5-15(6-3-13)28(24,25)22-8-10-27-11-9-22/h2-7,12H,8-11H2,1H3,(H,20,21) |
| InChIKey | XTMAEQBPDJNLMU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |