C16H19N3O6S2 — CID 2377955
methyl 4-[(6-morpholin-4-ylsulfonyl-1H-benzimidazol-2-yl)sulfanyl]-3-oxobutanoate (PubChem CID 2377955) has the molecular formula C16H19N3O6S2 and a molecular weight of 413.48 g/mol. Its IUPAC name is methyl 4-[(6-morpholin-4-ylsulfonyl-1H-benzimidazol-2-yl)sulfanyl]-3-oxobutanoate.
| Compound Name | methyl 4-[(6-morpholin-4-ylsulfonyl-1H-benzimidazol-2-yl)sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 2377955 |
| Molecular Formula | C16H19N3O6S2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | methyl 4-[(6-morpholin-4-ylsulfonyl-1H-benzimidazol-2-yl)sulfanyl]-3-oxobutanoate |
| SMILES | COC(=O)CC(=O)CSc1nc2ccc(S(=O)(=O)N3CCOCC3)cc2[nH]1 |
| InChI | InChI=1S/C16H19N3O6S2/c1-24-15(21)8-11(20)10-26-16-17-13-3-2-12(9-14(13)18-16)27(22,23)19-4-6-25-7-5-19/h2-3,9H,4-8,10H2,1H3,(H,17,18) |
| InChIKey | LHMMISJJJGZUME-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|