C20H23N3O4S — CID 2380869
4-[[2-[(2-ethylphenoxy)methyl]-3H-benzimidazol-5-yl]sulfonyl]morpholine (PubChem CID 2380869) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 4-[[2-[(2-ethylphenoxy)methyl]-3H-benzimidazol-5-yl]sulfonyl]morpholine.
| Compound Name | 4-[[2-[(2-ethylphenoxy)methyl]-3H-benzimidazol-5-yl]sulfonyl]morpholine |
|---|---|
| PubChem CID | 2380869 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[[2-[(2-ethylphenoxy)methyl]-3H-benzimidazol-5-yl]sulfonyl]morpholine |
| SMILES | CCc1ccccc1OCc1nc2ccc(S(=O)(=O)N3CCOCC3)cc2[nH]1 |
| InChI | InChI=1S/C20H23N3O4S/c1-2-15-5-3-4-6-19(15)27-14-20-21-17-8-7-16(13-18(17)22-20)28(24,25)23-9-11-26-12-10-23/h3-8,13H,2,9-12,14H2,1H3,(H,21,22) |
| InChIKey | OLZRVCSTFARURN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |