C11H17NO3 — CID 171872037
1-(2,6-dimethyl-4-pyridinyl)butane-1,2,4-triol (PubChem CID 171872037) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(2,6-dimethyl-4-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872037 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-(2,6-dimethyl-4-pyridinyl)butane-1,2,4-triol |
| SMILES | Cc1cc(C(O)C(O)CCO)cc(C)n1 |
| InChI | InChI=1S/C11H17NO3/c1-7-5-9(6-8(2)12-7)11(15)10(14)3-4-13/h5-6,10-11,13-15H,3-4H2,1-2H3 |
| InChIKey | ITACTZNCTJRMNV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |