C10H15NO4 — CID 171872087
1-(3-hydroxy-6-methyl-2-pyridinyl)butane-1,2,4-triol (PubChem CID 171872087) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 1-(3-hydroxy-6-methyl-2-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(3-hydroxy-6-methyl-2-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872087 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-(3-hydroxy-6-methyl-2-pyridinyl)butane-1,2,4-triol |
| SMILES | Cc1ccc(O)c(C(O)C(O)CCO)n1 |
| InChI | InChI=1S/C10H15NO4/c1-6-2-3-7(13)9(11-6)10(15)8(14)4-5-12/h2-3,8,10,12-15H,4-5H2,1H3 |
| InChIKey | DGMOJFHANWYKHH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |