C14H22O4 — CID 171872892
1-(3-tert-butyl-4-hydroxyphenyl)butane-1,2,4-triol (PubChem CID 171872892) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(3-tert-butyl-4-hydroxyphenyl)butane-1,2,4-triol.
| Compound Name | 1-(3-tert-butyl-4-hydroxyphenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872892 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-(3-tert-butyl-4-hydroxyphenyl)butane-1,2,4-triol |
| SMILES | CC(C)(C)c1cc(C(O)C(O)CCO)ccc1O |
| InChI | InChI=1S/C14H22O4/c1-14(2,3)10-8-9(4-5-11(10)16)13(18)12(17)6-7-15/h4-5,8,12-13,15-18H,6-7H2,1-3H3 |
| InChIKey | RVDVSJOCYANWEC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |