C48H74O2 — CID 175249442
2-tert-butyl-4-[1-[4-[1-(3-tert-butyl-4-hydroxyphenyl)-4,5,5-trimethylhexyl]-2,3,5,6-tetramethylphenyl]-4,5,5-trimethylhexyl]phenol (PubChem CID 175249442) has the molecular formula C48H74O2 and a molecular weight of 683.12 g/mol. Its IUPAC name is 2-tert-butyl-4-[1-[4-[1-(3-tert-butyl-4-hydroxyphenyl)-4,5,5-trimethylhexyl]-2,3,5,6-tetramethylphenyl]-4,5,5-trimethylhexyl]phenol.
| Compound Name | 2-tert-butyl-4-[1-[4-[1-(3-tert-butyl-4-hydroxyphenyl)-4,5,5-trimethylhexyl]-2,3,5,6-tetramethylphenyl]-4,5,5-trimethylhexyl]phenol |
|---|---|
| PubChem CID | 175249442 |
| Molecular Formula | C48H74O2 |
| Molecular Weight | 683.12 g/mol |
| Exact Mass | 682.57 |
| IUPAC Name | 2-tert-butyl-4-[1-[4-[1-(3-tert-butyl-4-hydroxyphenyl)-4,5,5-trimethylhexyl]-2,3,5,6-tetramethylphenyl]-4,5,5-trimethylhexyl]phenol |
| SMILES | Cc1c(C)c(C(CCC(C)C(C)(C)C)c2ccc(O)c(C(C)(C)C)c2)c(C)c(C)c1C(CCC(C)C(C)(C)C)c1ccc(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C48H74O2/c1-29(45(7,8)9)19-23-37(35-21-25-41(49)39(27-35)47(13,14)15)43-31(3)33(5)44(34(6)32(43)4)38(24-20-30(2)46(10,11)12)36-22-26-42(50)40(28-36)48(16,17)18/h21-22,25-30,37-38,49-50H,19-20,23-24H2,1-18H3 |
| InChIKey | IJWZDWWDKXBRJP-UHFFFAOYSA-N |
| XLogP | 14.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.12 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |