C12H15F3O4 — CID 171873170
1-[4-methoxy-3-(trifluoromethyl)phenyl]butane-1,2,4-triol (PubChem CID 171873170) has the molecular formula C12H15F3O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is 1-[4-methoxy-3-(trifluoromethyl)phenyl]butane-1,2,4-triol.
| Compound Name | 1-[4-methoxy-3-(trifluoromethyl)phenyl]butane-1,2,4-triol |
|---|---|
| PubChem CID | 171873170 |
| Molecular Formula | C12H15F3O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-[4-methoxy-3-(trifluoromethyl)phenyl]butane-1,2,4-triol |
| SMILES | COc1ccc(C(O)C(O)CCO)cc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3O4/c1-19-10-3-2-7(6-8(10)12(13,14)15)11(18)9(17)4-5-16/h2-3,6,9,11,16-18H,4-5H2,1H3 |
| InChIKey | ZKEQAKFFPSRORM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |