C12H12F6O3 — CID 171873297
1-[2,6-bis(trifluoromethyl)phenyl]butane-1,2,4-triol (PubChem CID 171873297) has the molecular formula C12H12F6O3 and a molecular weight of 318.21 g/mol. Its IUPAC name is 1-[2,6-bis(trifluoromethyl)phenyl]butane-1,2,4-triol.
| Compound Name | 1-[2,6-bis(trifluoromethyl)phenyl]butane-1,2,4-triol |
|---|---|
| PubChem CID | 171873297 |
| Molecular Formula | C12H12F6O3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 1-[2,6-bis(trifluoromethyl)phenyl]butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C12H12F6O3/c13-11(14,15)6-2-1-3-7(12(16,17)18)9(6)10(21)8(20)4-5-19/h1-3,8,10,19-21H,4-5H2 |
| InChIKey | NEBNSAOYUFYFLU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |