C11H9F6NO3 — CID 171869160
3-[2,6-bis(trifluoromethyl)phenyl]-2,3-dihydroxypropanamide (PubChem CID 171869160) has the molecular formula C11H9F6NO3 and a molecular weight of 317.19 g/mol. Its IUPAC name is 3-[2,6-bis(trifluoromethyl)phenyl]-2,3-dihydroxypropanamide.
| Compound Name | 3-[2,6-bis(trifluoromethyl)phenyl]-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171869160 |
| Molecular Formula | C11H9F6NO3 |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-[2,6-bis(trifluoromethyl)phenyl]-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C11H9F6NO3/c12-10(13,14)4-2-1-3-5(11(15,16)17)6(4)7(19)8(20)9(18)21/h1-3,7-8,19-20H,(H2,18,21) |
| InChIKey | LFQOJPMPFNCREH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |