C9H7F4NO2 — CID 99645736
(2R)-2-[2-fluoro-6-(trifluoromethyl)phenyl]-2-hydroxyacetamide (PubChem CID 99645736) has the molecular formula C9H7F4NO2 and a molecular weight of 237.15 g/mol. Its IUPAC name is (2R)-2-[2-fluoro-6-(trifluoromethyl)phenyl]-2-hydroxyacetamide.
| Compound Name | (2R)-2-[2-fluoro-6-(trifluoromethyl)phenyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 99645736 |
| Molecular Formula | C9H7F4NO2 |
| Molecular Weight | 237.15 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | (2R)-2-[2-fluoro-6-(trifluoromethyl)phenyl]-2-hydroxyacetamide |
| SMILES | NC(=O)[C@H](O)c1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C9H7F4NO2/c10-5-3-1-2-4(9(11,12)13)6(5)7(15)8(14)16/h1-3,7,15H,(H2,14,16)/t7-/m1/s1 |
| InChIKey | YHTRBJSDMKDBAZ-SSDOTTSWSA-N |
| XLogP | 1.36 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.15 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |