C11H10F3NO4 — CID 171869028
2,3-dihydroxy-3-[4-(2,2,2-trifluoroacetyl)phenyl]propanamide (PubChem CID 171869028) has the molecular formula C11H10F3NO4 and a molecular weight of 277.20 g/mol. Its IUPAC name is 2,3-dihydroxy-3-[4-(2,2,2-trifluoroacetyl)phenyl]propanamide.
| Compound Name | 2,3-dihydroxy-3-[4-(2,2,2-trifluoroacetyl)phenyl]propanamide |
|---|---|
| PubChem CID | 171869028 |
| Molecular Formula | C11H10F3NO4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2,3-dihydroxy-3-[4-(2,2,2-trifluoroacetyl)phenyl]propanamide |
| SMILES | NC(=O)C(O)C(O)c1ccc(C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F3NO4/c12-11(13,14)9(18)6-3-1-5(2-4-6)7(16)8(17)10(15)19/h1-4,7-8,16-17H,(H2,15,19) |
| InChIKey | CEXSAXBHNIJYJO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |