C8H7F3N2O — CID 15580662
2,2,2-trifluoro-1-(4-hydrazinylphenyl)ethanone (PubChem CID 15580662) has the molecular formula C8H7F3N2O and a molecular weight of 204.15 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-hydrazinylphenyl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(4-hydrazinylphenyl)ethanone |
|---|---|
| PubChem CID | 15580662 |
| Molecular Formula | C8H7F3N2O |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-hydrazinylphenyl)ethanone |
| SMILES | NNc1ccc(C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H7F3N2O/c9-8(10,11)7(14)5-1-3-6(13-12)4-2-5/h1-4,13H,12H2 |
| InChIKey | PJQFQKAOYFOVLI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|