About phosphono 4-hydrazinylbenzoate
phosphono 4-hydrazinylbenzoate (PubChem CID 138619693) has the molecular formula C7H9N2O5P
and a molecular weight of 232.13 g/mol. Its IUPAC name is phosphono 4-hydrazinylbenzoate.
Molecular Properties
| Compound Name | phosphono 4-hydrazinylbenzoate |
| PubChem CID | 138619693 |
| Molecular Formula | C7H9N2O5P |
| Molecular Weight | 232.13 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | phosphono 4-hydrazinylbenzoate |
| SMILES | NNc1ccc(C(=O)OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C7H9N2O5P/c8-9-6-3-1-5(2-4-6)7(10)14-15(11,12)13/h1-4,9H,8H2,(H2,11,12,13) |
| InChIKey | DSXUWBPDCGOQKQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.13 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphono 4-hydrazinylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphono 4-hydrazinylbenzoate?
The IUPAC name of phosphono 4-hydrazinylbenzoate (CID 138619693) is phosphono 4-hydrazinylbenzoate.
What is the SMILES notation for phosphono 4-hydrazinylbenzoate?
The canonical SMILES for phosphono 4-hydrazinylbenzoate is NNc1ccc(C(=O)OP(=O)(O)O)cc1.
What is the InChIKey of phosphono 4-hydrazinylbenzoate?
The InChIKey is DSXUWBPDCGOQKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N2O5P/c8-9-6-3-1-5(2-4-6)7(10)14-15(11,12)13/h1-4,9H,8H2,(H2,11,12,13).
What are the key properties of phosphono 4-hydrazinylbenzoate?
phosphono 4-hydrazinylbenzoate has a molecular weight of 232.13 g/mol, XLogP of 0.22, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phosphono 4-hydrazinylbenzoate is sourced from PubChem (CID 138619693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).