About azane;phosphono benzoate
azane;phosphono benzoate (PubChem CID 174881549) has the molecular formula C7H10NO5P
and a molecular weight of 219.13 g/mol. Its IUPAC name is azane;phosphono benzoate.
Molecular Properties
| Compound Name | azane;phosphono benzoate |
| PubChem CID | 174881549 |
| Molecular Formula | C7H10NO5P |
| Molecular Weight | 219.13 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | azane;phosphono benzoate |
| SMILES | N.O=C(OP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C7H7O5P.H3N/c8-7(12-13(9,10)11)6-4-2-1-3-5-6;/h1-5H,(H2,9,10,11);1H3 |
| InChIKey | KNBFOODPLFAQFK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.13 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;phosphono benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;phosphono benzoate?
The IUPAC name of azane;phosphono benzoate (CID 174881549) is azane;phosphono benzoate.
What is the SMILES notation for azane;phosphono benzoate?
The canonical SMILES for azane;phosphono benzoate is N.O=C(OP(=O)(O)O)c1ccccc1.
What is the InChIKey of azane;phosphono benzoate?
The InChIKey is KNBFOODPLFAQFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O5P.H3N/c8-7(12-13(9,10)11)6-4-2-1-3-5-6;/h1-5H,(H2,9,10,11);1H3.
What are the key properties of azane;phosphono benzoate?
azane;phosphono benzoate has a molecular weight of 219.13 g/mol, XLogP of 1.10, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;phosphono benzoate is sourced from PubChem (CID 174881549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).