C10H9F3N2O2 — CID 595397
1-methyl-3-[4-(2,2,2-trifluoroacetyl)phenyl]urea (PubChem CID 595397) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is 1-methyl-3-[4-(2,2,2-trifluoroacetyl)phenyl]urea.
| Compound Name | 1-methyl-3-[4-(2,2,2-trifluoroacetyl)phenyl]urea |
|---|---|
| PubChem CID | 595397 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1-methyl-3-[4-(2,2,2-trifluoroacetyl)phenyl]urea |
| SMILES | CNC(=O)Nc1ccc(C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H9F3N2O2/c1-14-9(17)15-7-4-2-6(3-5-7)8(16)10(11,12)13/h2-5H,1H3,(H2,14,15,17) |
| InChIKey | ALKSWQNAKMWAQY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |